C16H16ClN5 — CID 125423911
6-[(2R)-4-(3-chlorophenyl)-2-methylpiperazin-1-yl]pyrimidine-4-carbonitrile (PubChem CID 125423911) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is 6-[(2R)-4-(3-chlorophenyl)-2-methylpiperazin-1-yl]pyrimidine-4-carbonitrile.
| Compound Name | 6-[(2R)-4-(3-chlorophenyl)-2-methylpiperazin-1-yl]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 125423911 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-[(2R)-4-(3-chlorophenyl)-2-methylpiperazin-1-yl]pyrimidine-4-carbonitrile |
| SMILES | C[C@@H]1CN(c2cccc(Cl)c2)CCN1c1cc(C#N)ncn1 |
| InChI | InChI=1S/C16H16ClN5/c1-12-10-21(15-4-2-3-13(17)7-15)5-6-22(12)16-8-14(9-18)19-11-20-16/h2-4,7-8,11-12H,5-6,10H2,1H3/t12-/m1/s1 |
| InChIKey | LQHYWUKVGDTLAU-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |