C19H19NO — CID 929245
(2S,4S,5S)-3,4-dimethyl-5-phenyl-2-(2-phenylethynyl)-1,3-oxazolidine (PubChem CID 929245) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (2S,4S,5S)-3,4-dimethyl-5-phenyl-2-(2-phenylethynyl)-1,3-oxazolidine.
| Compound Name | (2S,4S,5S)-3,4-dimethyl-5-phenyl-2-(2-phenylethynyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 929245 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2S,4S,5S)-3,4-dimethyl-5-phenyl-2-(2-phenylethynyl)-1,3-oxazolidine |
| SMILES | C[C@H]1[C@H](c2ccccc2)O[C@@H](C#Cc2ccccc2)N1C |
| InChI | InChI=1S/C19H19NO/c1-15-19(17-11-7-4-8-12-17)21-18(20(15)2)14-13-16-9-5-3-6-10-16/h3-12,15,18-19H,1-2H3/t15-,18-,19+/m0/s1 |
| InChIKey | YIEKZEKWISFCPM-ZYSHUDEJSA-N |
| XLogP | 3.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|