C16H19NO4S — CID 92936565
2-[5-ethyl-2-oxo-4-(4-propoxyphenyl)-1,3-thiazol-3-yl]acetic acid (PubChem CID 92936565) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[5-ethyl-2-oxo-4-(4-propoxyphenyl)-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[5-ethyl-2-oxo-4-(4-propoxyphenyl)-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 92936565 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[5-ethyl-2-oxo-4-(4-propoxyphenyl)-1,3-thiazol-3-yl]acetic acid |
| SMILES | CCCOc1ccc(-c2c(CC)sc(=O)n2CC(=O)O)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-3-9-21-12-7-5-11(6-8-12)15-13(4-2)22-16(20)17(15)10-14(18)19/h5-8H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | ASKFLEDPZZJCQM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |