C16H19NO4S2 — CID 54019027
2-[5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 54019027) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 54019027 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | CCCCOc1ccc(Cc2sc(=S)n(CC(=O)O)c2O)cc1 |
| InChI | InChI=1S/C16H19NO4S2/c1-2-3-8-21-12-6-4-11(5-7-12)9-13-15(20)17(10-14(18)19)16(22)23-13/h4-7,20H,2-3,8-10H2,1H3,(H,18,19) |
| InChIKey | KXPXRYLMTUSXAE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|