C20H20N2O5S2 — CID 92949631
(2R)-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-methylpropanamide (PubChem CID 92949631) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-methylpropanamide.
| Compound Name | (2R)-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 92949631 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (2R)-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]-N-methylpropanamide |
| SMILES | C[C@H](C(=O)N(C)C[C@@H](O)c1ccc(O)cc1)N1C(=O)/C(=C/c2ccco2)SC1=S |
| InChI | InChI=1S/C20H20N2O5S2/c1-12(18(25)21(2)11-16(24)13-5-7-14(23)8-6-13)22-19(26)17(29-20(22)28)10-15-4-3-9-27-15/h3-10,12,16,23-24H,11H2,1-2H3/b17-10-/t12-,16-/m1/s1 |
| InChIKey | GEYLAKDAPIRPEN-MVKJJVDBSA-N |
| XLogP | 2.77 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|