C18H19FN6OS — CID 9296232
4-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-[(2R)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 9296232) has the molecular formula C18H19FN6OS and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-[(2R)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-[(2R)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9296232 |
| Molecular Formula | C18H19FN6OS |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[(Z)-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-[(2R)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=N\n1c([C@H]2CCCO2)n[nH]c1=S |
| InChI | InChI=1S/C18H19FN6OS/c1-11-15(12(2)24(23-11)14-7-5-13(19)6-8-14)10-20-25-17(21-22-18(25)27)16-4-3-9-26-16/h5-8,10,16H,3-4,9H2,1-2H3,(H,22,27)/b20-10-/t16-/m1/s1 |
| InChIKey | VOLOPDDQSHTMPJ-HSGPEQJXSA-N |
| XLogP | 3.62 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|