C25H30N4O4S — CID 92963223
(Z)-2-cyano-N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 92963223) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is (Z)-2-cyano-N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 92963223 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (Z)-2-cyano-N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NC(=O)/C(C#N)=C\c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H30N4O4S/c1-4-29(5-2)34(31,32)22-12-13-24(28-14-6-7-15-28)23(17-22)27-25(30)20(18-26)16-19-8-10-21(33-3)11-9-19/h8-13,16-17H,4-7,14-15H2,1-3H3,(H,27,30)/b20-16- |
| InChIKey | KJUGXTWLDKPJPP-SILNSSARSA-N |
| XLogP | 3.87 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|