C22H15BrN2O3S — CID 92976701
2-[(2R,3R)-2-(5-bromothiophen-2-yl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 92976701) has the molecular formula C22H15BrN2O3S and a molecular weight of 467.34 g/mol. Its IUPAC name is 2-[(2R,3R)-2-(5-bromothiophen-2-yl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R)-2-(5-bromothiophen-2-yl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 92976701 |
| Molecular Formula | C22H15BrN2O3S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2-[(2R,3R)-2-(5-bromothiophen-2-yl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H](N3C(=O)c4ccccc4C3=O)[C@@H]2c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C22H15BrN2O3S/c1-12-6-8-13(9-7-12)24-18(16-10-11-17(23)29-16)19(22(24)28)25-20(26)14-4-2-3-5-15(14)21(25)27/h2-11,18-19H,1H3/t18-,19+/m0/s1 |
| InChIKey | YFSZAEZNBABLFF-RBUKOAKNSA-N |
| XLogP | 4.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|