C19H19ClN2O3 — CID 9297806
N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 9297806) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 9297806 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)c1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C19H19ClN2O3/c20-14-7-9-15(10-8-14)25-13-11-21-19(24)16-4-1-2-5-17(16)22-12-3-6-18(22)23/h1-2,4-5,7-10H,3,6,11-13H2,(H,21,24) |
| InChIKey | KFHKIYVJPQNQSY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|