C18H17ClN4O2S — CID 9317516
1-(4-chlorophenyl)-3-[[2-(2-oxopyrrolidin-1-yl)benzoyl]amino]thiourea (PubChem CID 9317516) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-(2-oxopyrrolidin-1-yl)benzoyl]amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-(2-oxopyrrolidin-1-yl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9317516 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-(2-oxopyrrolidin-1-yl)benzoyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Cl)cc1)c1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C18H17ClN4O2S/c19-12-7-9-13(10-8-12)20-18(26)22-21-17(25)14-4-1-2-5-15(14)23-11-3-6-16(23)24/h1-2,4-5,7-10H,3,6,11H2,(H,21,25)(H2,20,22,26) |
| InChIKey | QJISLEOXQNFFQD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|