C5H10N2O2 — CID 92980363
(3S,4R)-3-amino-1-hydroxy-4-methylpyrrolidin-2-one (PubChem CID 92980363) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-hydroxy-4-methylpyrrolidin-2-one.
| Compound Name | (3S,4R)-3-amino-1-hydroxy-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 92980363 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | (3S,4R)-3-amino-1-hydroxy-4-methylpyrrolidin-2-one |
| SMILES | C[C@@H]1CN(O)C(=O)[C@H]1N |
| InChI | InChI=1S/C5H10N2O2/c1-3-2-7(9)5(8)4(3)6/h3-4,9H,2,6H2,1H3/t3-,4+/m1/s1 |
| InChIKey | SKYSFPFYQBZGDC-DMTCNVIQSA-N |
| XLogP | -0.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|