C16H26N2O7S — CID 93000621
(3S,4S)-N-(2-methoxyethyl)-2-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 93000621) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is (3S,4S)-N-(2-methoxyethyl)-2-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | (3S,4S)-N-(2-methoxyethyl)-2-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 93000621 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (3S,4S)-N-(2-methoxyethyl)-2-methyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | COCCNS(=O)(=O)[C@@H]1CON(C)[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26N2O7S/c1-18-15(14(10-25-18)26(19,20)17-6-7-21-2)11-8-12(22-3)16(24-5)13(9-11)23-4/h8-9,14-15,17H,6-7,10H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | OUPIWCOROGSWMF-CABCVRRESA-N |
| XLogP | 0.56 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|