C24H30N4O2 — CID 93013854
(3S)-1-(1-cyclohexylbenzimidazol-2-yl)-N-(furan-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 93013854) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (3S)-1-(1-cyclohexylbenzimidazol-2-yl)-N-(furan-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(1-cyclohexylbenzimidazol-2-yl)-N-(furan-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93013854 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (3S)-1-(1-cyclohexylbenzimidazol-2-yl)-N-(furan-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@H]1CCCN(c2nc3ccccc3n2C2CCCCC2)C1 |
| InChI | InChI=1S/C24H30N4O2/c29-23(25-16-20-11-7-15-30-20)18-8-6-14-27(17-18)24-26-21-12-4-5-13-22(21)28(24)19-9-2-1-3-10-19/h4-5,7,11-13,15,18-19H,1-3,6,8-10,14,16-17H2,(H,25,29)/t18-/m0/s1 |
| InChIKey | GJNKNYYVUFXMDH-SFHVURJKSA-N |
| XLogP | 4.67 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |