C15H16Cl2N2O2S2 — CID 9301421
1-(4-chlorophenyl)sulfonyl-4-[(5-chlorothiophen-2-yl)methyl]piperazine (PubChem CID 9301421) has the molecular formula C15H16Cl2N2O2S2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-[(5-chlorothiophen-2-yl)methyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-[(5-chlorothiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 9301421 |
| Molecular Formula | C15H16Cl2N2O2S2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-[(5-chlorothiophen-2-yl)methyl]piperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H16Cl2N2O2S2/c16-12-1-4-14(5-2-12)23(20,21)19-9-7-18(8-10-19)11-13-3-6-15(17)22-13/h1-6H,7-11H2 |
| InChIKey | JDTRXNBMLQJAMH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |