C18H19BrN3O+ — CID 9303360
[2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(3-cyanophenyl)methyl]-methylazanium (PubChem CID 9303360) has the molecular formula C18H19BrN3O+ and a molecular weight of 373.27 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(3-cyanophenyl)methyl]-methylazanium.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(3-cyanophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9303360 |
| Molecular Formula | C18H19BrN3O+ |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(3-cyanophenyl)methyl]-methylazanium |
| SMILES | Cc1cc(Br)ccc1NC(=O)C[NH+](C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H18BrN3O/c1-13-8-16(19)6-7-17(13)21-18(23)12-22(2)11-15-5-3-4-14(9-15)10-20/h3-9H,11-12H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | LVCQGNSNWLRHMT-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |