C22H20N4O2 — CID 93062533
1H-indol-2-yl-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]methanone (PubChem CID 93062533) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1H-indol-2-yl-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93062533 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1H-indol-2-yl-[(3S)-3-(5-phenyl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCC[C@H](c2nnc(-c3ccccc3)o2)C1 |
| InChI | InChI=1S/C22H20N4O2/c27-22(19-13-16-9-4-5-11-18(16)23-19)26-12-6-10-17(14-26)21-25-24-20(28-21)15-7-2-1-3-8-15/h1-5,7-9,11,13,17,23H,6,10,12,14H2/t17-/m0/s1 |
| InChIKey | GAIVIBWWDPHPLK-KRWDZBQOSA-N |
| XLogP | 4.24 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |