C20H28N4OS — CID 93068846
1-methyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4,5-dihydrothieno[2,3-g]indazole-3-carboxamide (PubChem CID 93068846) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-methyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4,5-dihydrothieno[2,3-g]indazole-3-carboxamide.
| Compound Name | 1-methyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4,5-dihydrothieno[2,3-g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 93068846 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-methyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4,5-dihydrothieno[2,3-g]indazole-3-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)c2nn(C)c3c2CCc2sccc2-3)C1 |
| InChI | InChI=1S/C20H28N4OS/c1-14-5-3-10-24(13-14)11-4-9-21-20(25)18-16-6-7-17-15(8-12-26-17)19(16)23(2)22-18/h8,12,14H,3-7,9-11,13H2,1-2H3,(H,21,25)/t14-/m1/s1 |
| InChIKey | PDWAEWTWZKSESO-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|