C22H23N5O2S2 — CID 93072029
8-benzyl-12-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 93072029) has the molecular formula C22H23N5O2S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 8-benzyl-12-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-benzyl-12-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 93072029 |
| Molecular Formula | C22H23N5O2S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 8-benzyl-12-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | C[C@@H]1CCCCN1C(=O)CSc1nnc2n(Cc3ccccc3)c(=O)c3sccc3n12 |
| InChI | InChI=1S/C22H23N5O2S2/c1-15-7-5-6-11-25(15)18(28)14-31-22-24-23-21-26(13-16-8-3-2-4-9-16)20(29)19-17(27(21)22)10-12-30-19/h2-4,8-10,12,15H,5-7,11,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | BEKBQGOPTRALBH-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |