C23H29FN2O3S — CID 93116678
2-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-[(2R)-2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 93116678) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-[(2R)-2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-[(2R)-2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 93116678 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-[(2R)-2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | COCCCN(CC(=O)N1CCS[C@@H]1c1ccc(OC)cc1)Cc1ccccc1F |
| InChI | InChI=1S/C23H29FN2O3S/c1-28-14-5-12-25(16-19-6-3-4-7-21(19)24)17-22(27)26-13-15-30-23(26)18-8-10-20(29-2)11-9-18/h3-4,6-11,23H,5,12-17H2,1-2H3/t23-/m1/s1 |
| InChIKey | UTCQBELQLOZHEI-HSZRJFAPSA-N |
| XLogP | 3.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|