C24H29FN2O4S — CID 93116698
benzyl 2-[[2-[(2R)-2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]-(3-methoxypropyl)amino]acetate (PubChem CID 93116698) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is benzyl 2-[[2-[(2R)-2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]-(3-methoxypropyl)amino]acetate.
| Compound Name | benzyl 2-[[2-[(2R)-2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]-(3-methoxypropyl)amino]acetate |
|---|---|
| PubChem CID | 93116698 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | benzyl 2-[[2-[(2R)-2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]-(3-methoxypropyl)amino]acetate |
| SMILES | COCCCN(CC(=O)OCc1ccccc1)CC(=O)N1CCS[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FN2O4S/c1-30-14-5-12-26(17-23(29)31-18-19-6-3-2-4-7-19)16-22(28)27-13-15-32-24(27)20-8-10-21(25)11-9-20/h2-4,6-11,24H,5,12-18H2,1H3/t24-/m1/s1 |
| InChIKey | INLSCKBZRKYGLB-XMMPIXPASA-N |
| XLogP | 3.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|