C25H31N3O2 — CID 93119092
(4aS,5S)-3-cyclopentyl-N-(3-methoxyphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119092) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4aS,5S)-3-cyclopentyl-N-(3-methoxyphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-cyclopentyl-N-(3-methoxyphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119092 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (4aS,5S)-3-cyclopentyl-N-(3-methoxyphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@H]2Cc3ccccc3N3CCN(C4CCCC4)C[C@H]23)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-30-21-11-6-8-19(16-21)26-25(29)22-15-18-7-2-5-12-23(18)28-14-13-27(17-24(22)28)20-9-3-4-10-20/h2,5-8,11-12,16,20,22,24H,3-4,9-10,13-15,17H2,1H3,(H,26,29)/t22-,24+/m0/s1 |
| InChIKey | BNOFXMNAWAIVGP-LADGPHEKSA-N |
| XLogP | 3.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |