C21H21N3O2 — CID 11919026
(3aR,4R)-4-cyano-N-(3-methoxyphenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carboxamide (PubChem CID 11919026) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3aR,4R)-4-cyano-N-(3-methoxyphenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carboxamide.
| Compound Name | (3aR,4R)-4-cyano-N-(3-methoxyphenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11919026 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3aR,4R)-4-cyano-N-(3-methoxyphenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@]2(C#N)Cc3ccccc3N3CCC[C@@H]32)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-26-17-8-4-7-16(12-17)23-20(25)21(14-22)13-15-6-2-3-9-18(15)24-11-5-10-19(21)24/h2-4,6-9,12,19H,5,10-11,13H2,1H3,(H,23,25)/t19-,21+/m1/s1 |
| InChIKey | ZNKAYEUCVTXDGU-CTNGQTDRSA-N |
| XLogP | 3.37 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |