C27H29N3O2S — CID 93127857
(2R)-N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylbutanamide (PubChem CID 93127857) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is (2R)-N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 93127857 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (2R)-N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc([C@H]2SCC(=O)N2c2ccc(N(C)C)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O2S/c1-4-24(19-9-6-5-7-10-19)26(32)28-21-12-8-11-20(17-21)27-30(25(31)18-33-27)23-15-13-22(14-16-23)29(2)3/h5-17,24,27H,4,18H2,1-3H3,(H,28,32)/t24-,27-/m1/s1 |
| InChIKey | YUDYTNDMXUAFPK-SHQCIBLASA-N |
| XLogP | 5.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|