C31H29N3O2S — CID 93127787
N-[4-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2,2-diphenylacetamide (PubChem CID 93127787) has the molecular formula C31H29N3O2S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-[4-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 93127787 |
| Molecular Formula | C31H29N3O2S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-[4-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2,2-diphenylacetamide |
| SMILES | CN(C)c1ccc(N2C(=O)CS[C@@H]2c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O2S/c1-33(2)26-17-19-27(20-18-26)34-28(35)21-37-31(34)24-13-15-25(16-14-24)32-30(36)29(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-20,29,31H,21H2,1-2H3,(H,32,36)/t31-/m1/s1 |
| InChIKey | BQBKKRQJGFNCRP-WJOKGBTCSA-N |
| XLogP | 6.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|