C24H20N2O2S — CID 42804068
(E)-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]-3-phenylprop-2-enamide (PubChem CID 42804068) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is (E)-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42804068 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (E)-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc(C2SCC(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O2S/c27-22(16-11-18-7-3-1-4-8-18)25-20-14-12-19(13-15-20)24-26(23(28)17-29-24)21-9-5-2-6-10-21/h1-16,24H,17H2,(H,25,27)/b16-11+ |
| InChIKey | OISVMYXBFRJSEU-LFIBNONCSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|