C24H32ClN3O4S — CID 93128846
N-[3-[[(3-chlorophenyl)sulfonyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide (PubChem CID 93128846) has the molecular formula C24H32ClN3O4S and a molecular weight of 494.06 g/mol. Its IUPAC name is N-[3-[[(3-chlorophenyl)sulfonyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[[(3-chlorophenyl)sulfonyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 93128846 |
| Molecular Formula | C24H32ClN3O4S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[3-[[(3-chlorophenyl)sulfonyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(N(C)C)c(CN(C[C@@H]2CCCO2)S(=O)(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H32ClN3O4S/c1-17(2)24(29)26-20-10-11-23(27(3)4)18(13-20)15-28(16-21-8-6-12-32-21)33(30,31)22-9-5-7-19(25)14-22/h5,7,9-11,13-14,17,21H,6,8,12,15-16H2,1-4H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | DUUUYFIHNFTXIT-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|