C21H28N2O2 — CID 93135701
(2R)-1-[5-(cyclopropylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]-3-prop-2-enoxypropan-2-ol (PubChem CID 93135701) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2R)-1-[5-(cyclopropylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[5-(cyclopropylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93135701 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2R)-1-[5-(cyclopropylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN1CCc2c(c3ccccc3n2CC2CC2)C1 |
| InChI | InChI=1S/C21H28N2O2/c1-2-11-25-15-17(24)13-22-10-9-21-19(14-22)18-5-3-4-6-20(18)23(21)12-16-7-8-16/h2-6,16-17,24H,1,7-15H2/t17-/m1/s1 |
| InChIKey | WLQNWUQOUIMIHC-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|