C20H19ClN2O4 — CID 9313790
(4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 9313790) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313790 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)=N/C1=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19ClN2O4/c21-20-9-13-4-14(10-20)8-19(7-13,11-20)18-22-16(17(24)27-18)6-12-2-1-3-15(5-12)23(25)26/h1-3,5-6,13-14H,4,7-11H2/b16-6-/t13-,14+,19?,20? |
| InChIKey | BMIRDMKQEAEMLJ-NDJXHCFSSA-N |
| XLogP | 4.47 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|