C27H43N5OS — CID 93146165
(2S)-4-(1-benzylpiperidin-4-yl)-2-[(2R)-butan-2-yl]-3-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 93146165) has the molecular formula C27H43N5OS and a molecular weight of 485.74 g/mol. Its IUPAC name is (2S)-4-(1-benzylpiperidin-4-yl)-2-[(2R)-butan-2-yl]-3-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | (2S)-4-(1-benzylpiperidin-4-yl)-2-[(2R)-butan-2-yl]-3-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 93146165 |
| Molecular Formula | C27H43N5OS |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | (2S)-4-(1-benzylpiperidin-4-yl)-2-[(2R)-butan-2-yl]-3-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | CCCNC(=S)N1CCC2(CC1)N[C@@H]([C@H](C)CC)C(=O)N2C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H43N5OS/c1-4-15-28-26(34)31-18-13-27(14-19-31)29-24(21(3)5-2)25(33)32(27)23-11-16-30(17-12-23)20-22-9-7-6-8-10-22/h6-10,21,23-24,29H,4-5,11-20H2,1-3H3,(H,28,34)/t21-,24+/m1/s1 |
| InChIKey | LKILRSJWGMPWAS-QPPBQGQZSA-N |
| XLogP | 3.57 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|