C21H29FN4OS — CID 93146383
(2S)-2-[(2S)-butan-2-yl]-N-(2-fluorophenyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 93146383) has the molecular formula C21H29FN4OS and a molecular weight of 404.56 g/mol. Its IUPAC name is (2S)-2-[(2S)-butan-2-yl]-N-(2-fluorophenyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | (2S)-2-[(2S)-butan-2-yl]-N-(2-fluorophenyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 93146383 |
| Molecular Formula | C21H29FN4OS |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2S)-2-[(2S)-butan-2-yl]-N-(2-fluorophenyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | C=CCN1C(=O)[C@H]([C@@H](C)CC)NC12CCN(C(=S)Nc1ccccc1F)CC2 |
| InChI | InChI=1S/C21H29FN4OS/c1-4-12-26-19(27)18(15(3)5-2)24-21(26)10-13-25(14-11-21)20(28)23-17-9-7-6-8-16(17)22/h4,6-9,15,18,24H,1,5,10-14H2,2-3H3,(H,23,28)/t15-,18-/m0/s1 |
| InChIKey | XVEQQBCZEHFSMY-YJBOKZPZSA-N |
| XLogP | 3.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|