C22H33FN4OS — CID 97478782
(2R)-2,4-bis[(2S)-butan-2-yl]-N-(4-fluorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 97478782) has the molecular formula C22H33FN4OS and a molecular weight of 420.60 g/mol. Its IUPAC name is (2R)-2,4-bis[(2S)-butan-2-yl]-N-(4-fluorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | (2R)-2,4-bis[(2S)-butan-2-yl]-N-(4-fluorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 97478782 |
| Molecular Formula | C22H33FN4OS |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (2R)-2,4-bis[(2S)-butan-2-yl]-N-(4-fluorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | CC[C@H](C)[C@H]1NC2(CCN(C(=S)Nc3ccc(F)cc3)CC2)N([C@@H](C)CC)C1=O |
| InChI | InChI=1S/C22H33FN4OS/c1-5-15(3)19-20(28)27(16(4)6-2)22(25-19)11-13-26(14-12-22)21(29)24-18-9-7-17(23)8-10-18/h7-10,15-16,19,25H,5-6,11-14H2,1-4H3,(H,24,29)/t15-,16-,19+/m0/s1 |
| InChIKey | HZJRUVLRAICOKQ-TXPKVOOTSA-N |
| XLogP | 3.96 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|