C26H32N4OS — CID 93146539
(2S)-2-benzyl-4-(cyclopropylmethyl)-N-(3-methylphenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 93146539) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is (2S)-2-benzyl-4-(cyclopropylmethyl)-N-(3-methylphenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | (2S)-2-benzyl-4-(cyclopropylmethyl)-N-(3-methylphenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 93146539 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (2S)-2-benzyl-4-(cyclopropylmethyl)-N-(3-methylphenyl)-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCC3(CC2)N[C@@H](Cc2ccccc2)C(=O)N3CC2CC2)c1 |
| InChI | InChI=1S/C26H32N4OS/c1-19-6-5-9-22(16-19)27-25(32)29-14-12-26(13-15-29)28-23(17-20-7-3-2-4-8-20)24(31)30(26)18-21-10-11-21/h2-9,16,21,23,28H,10-15,17-18H2,1H3,(H,27,32)/t23-/m0/s1 |
| InChIKey | ZDQGNRKFZLJBHT-QHCPKHFHSA-N |
| XLogP | 3.94 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|