C18H19N5O5 — CID 93151774
(4S)-6-amino-3-tert-butyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 93151774) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is (4S)-6-amino-3-tert-butyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-tert-butyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 93151774 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (4S)-6-amino-3-tert-butyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1cc([C@H]2C(C#N)=C(N)Oc3n[nH]c(C(C)(C)C)c32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H19N5O5/c1-18(2,3)15-13-12(9(7-19)16(20)28-17(13)22-21-15)8-5-10(23(25)26)14(24)11(6-8)27-4/h5-6,12,24H,20H2,1-4H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | QHXILFWZPMMLPD-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|