C21H16ClN5O5 — CID 40844201
(4S)-6-amino-3-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 40844201) has the molecular formula C21H16ClN5O5 and a molecular weight of 453.84 g/mol. Its IUPAC name is (4S)-6-amino-3-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 40844201 |
| Molecular Formula | C21H16ClN5O5 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (4S)-6-amino-3-(4-chlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCOc1cc([C@H]2C(C#N)=C(N)Oc3n[nH]c(-c4ccc(Cl)cc4)c32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C21H16ClN5O5/c1-2-31-15-8-11(7-14(19(15)28)27(29)30)16-13(9-23)20(24)32-21-17(16)18(25-26-21)10-3-5-12(22)6-4-10/h3-8,16,28H,2,24H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | FCHSDORHSKCATK-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|