C21H15Cl2N5O5 — CID 40844800
(4R)-6-amino-3-(3,4-dichlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 40844800) has the molecular formula C21H15Cl2N5O5 and a molecular weight of 488.29 g/mol. Its IUPAC name is (4R)-6-amino-3-(3,4-dichlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-(3,4-dichlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 40844800 |
| Molecular Formula | C21H15Cl2N5O5 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | (4R)-6-amino-3-(3,4-dichlorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCOc1cc([C@@H]2C(C#N)=C(N)Oc3n[nH]c(-c4ccc(Cl)c(Cl)c4)c32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C21H15Cl2N5O5/c1-2-32-15-7-10(6-14(19(15)29)28(30)31)16-11(8-24)20(25)33-21-17(16)18(26-27-21)9-3-4-12(22)13(23)5-9/h3-7,16,29H,2,25H2,1H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | MVFGQGIBPPACDD-MRXNPFEDSA-N |
| XLogP | 4.61 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|