C23H23F2NO2 — CID 93164801
(2R)-1-[benzyl-[(2,4-difluorophenyl)methyl]amino]-3-phenoxypropan-2-ol (PubChem CID 93164801) has the molecular formula C23H23F2NO2 and a molecular weight of 383.44 g/mol. Its IUPAC name is (2R)-1-[benzyl-[(2,4-difluorophenyl)methyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[benzyl-[(2,4-difluorophenyl)methyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93164801 |
| Molecular Formula | C23H23F2NO2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (2R)-1-[benzyl-[(2,4-difluorophenyl)methyl]amino]-3-phenoxypropan-2-ol |
| SMILES | O[C@@H](COc1ccccc1)CN(Cc1ccccc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C23H23F2NO2/c24-20-12-11-19(23(25)13-20)15-26(14-18-7-3-1-4-8-18)16-21(27)17-28-22-9-5-2-6-10-22/h1-13,21,27H,14-17H2/t21-/m1/s1 |
| InChIKey | POBSJETYSLCPNF-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |