C20H17N3O5 — CID 9320637
1-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-3-(furan-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 9320637) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-3-(furan-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-3-(furan-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9320637 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-3-(furan-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | CCc1cccc2c(C(=O)CN3C(=O)C(=O)N(Cc4ccco4)C3=O)c[nH]c12 |
| InChI | InChI=1S/C20H17N3O5/c1-2-12-5-3-7-14-15(9-21-17(12)14)16(24)11-23-19(26)18(25)22(20(23)27)10-13-6-4-8-28-13/h3-9,21H,2,10-11H2,1H3 |
| InChIKey | WTIQCRWZDUEKOU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|