C20H15N3O5 — CID 7233446
2-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 7233446) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7233446 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | CCc1cccc2c(C(=O)CN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)c[nH]c12 |
| InChI | InChI=1S/C20H15N3O5/c1-2-11-5-3-6-12-14(9-21-18(11)12)16(24)10-22-19(25)13-7-4-8-15(23(27)28)17(13)20(22)26/h3-9,21H,2,10H2,1H3 |
| InChIKey | XYMSGTOKHYXIGU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|