C25H39N3O3 — CID 93208074
(2S)-1-[3-methylbutyl-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93208074) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is (2S)-1-[3-methylbutyl-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[3-methylbutyl-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93208074 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | (2S)-1-[3-methylbutyl-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(CCC(C)C)Cc1c(-c2ccccc2)noc1N(C)C(C)C |
| InChI | InChI=1S/C25H39N3O3/c1-7-15-30-18-22(29)16-28(14-13-19(2)3)17-23-24(21-11-9-8-10-12-21)26-31-25(23)27(6)20(4)5/h7-12,19-20,22,29H,1,13-18H2,2-6H3/t22-/m0/s1 |
| InChIKey | GHADVQLYUVMBMH-QFIPXVFZSA-N |
| XLogP | 4.60 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|