C18H22N5O3+ — CID 9322412
methyl-[(1-phenylpyrazol-4-yl)methyl]-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]azanium (PubChem CID 9322412) has the molecular formula C18H22N5O3+ and a molecular weight of 356.41 g/mol. Its IUPAC name is methyl-[(1-phenylpyrazol-4-yl)methyl]-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]azanium.
| Compound Name | methyl-[(1-phenylpyrazol-4-yl)methyl]-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9322412 |
| Molecular Formula | C18H22N5O3+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl-[(1-phenylpyrazol-4-yl)methyl]-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]azanium |
| SMILES | CCCN1C(=O)C(=O)N(C[NH+](C)Cc2cnn(-c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C18H21N5O3/c1-3-9-21-16(24)17(25)22(18(21)26)13-20(2)11-14-10-19-23(12-14)15-7-5-4-6-8-15/h4-8,10,12H,3,9,11,13H2,1-2H3/p+1 |
| InChIKey | YOIDRJXHXRRUOM-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|