C21H28N5O2+ — CID 9321921
methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(1-phenylpyrazol-4-yl)methyl]azanium (PubChem CID 9321921) has the molecular formula C21H28N5O2+ and a molecular weight of 382.49 g/mol. Its IUPAC name is methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(1-phenylpyrazol-4-yl)methyl]azanium.
| Compound Name | methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(1-phenylpyrazol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9321921 |
| Molecular Formula | C21H28N5O2+ |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(1-phenylpyrazol-4-yl)methyl]azanium |
| SMILES | CC1CCC2(CC1)NC(=O)N(C[NH+](C)Cc1cnn(-c3ccccc3)c1)C2=O |
| InChI | InChI=1S/C21H27N5O2/c1-16-8-10-21(11-9-16)19(27)25(20(28)23-21)15-24(2)13-17-12-22-26(14-17)18-6-4-3-5-7-18/h3-7,12,14,16H,8-11,13,15H2,1-2H3,(H,23,28)/p+1 |
| InChIKey | HACCHMJLNAEGKX-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|