C19H20N4O2 — CID 71924329
5,5-dicyclopropyl-3-[(1-phenylpyrazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 71924329) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-[(1-phenylpyrazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dicyclopropyl-3-[(1-phenylpyrazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71924329 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5,5-dicyclopropyl-3-[(1-phenylpyrazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(C2CC2)(C2CC2)C(=O)N1Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N4O2/c24-17-19(14-6-7-14,15-8-9-15)21-18(25)22(17)11-13-10-20-23(12-13)16-4-2-1-3-5-16/h1-5,10,12,14-15H,6-9,11H2,(H,21,25) |
| InChIKey | XWRPNMCZPLESHP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|