C23H31NO5 — CID 9322625
1-[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 9322625) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 9322625 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | COc1ccc(C(OC[C@@H](O)CN2CCC(O)CC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H31NO5/c1-27-21-7-3-17(4-8-21)23(18-5-9-22(28-2)10-6-18)29-16-20(26)15-24-13-11-19(25)12-14-24/h3-10,19-20,23,25-26H,11-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | NJNUBWLIMCVXJL-FQEVSTJZSA-N |
| XLogP | 2.63 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |