C24H24N2O4 — CID 9322656
N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]-2-hydroxyphenyl]-2-methylbenzamide (PubChem CID 9322656) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]-2-hydroxyphenyl]-2-methylbenzamide.
| Compound Name | N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]-2-hydroxyphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 9322656 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]-2-hydroxyphenyl]-2-methylbenzamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(NC(=O)c3ccccc3C)c(O)c2)c(C)c1 |
| InChI | InChI=1S/C24H24N2O4/c1-15-8-11-22(17(3)12-15)30-14-23(28)25-18-9-10-20(21(27)13-18)26-24(29)19-7-5-4-6-16(19)2/h4-13,27H,14H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | BURCBHFPWWQPKB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|