C26H27ClN2O4 — CID 17362970
4-tert-butyl-N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-hydroxyphenyl]benzamide (PubChem CID 17362970) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 17362970 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-tert-butyl-N-[4-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-hydroxyphenyl]benzamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C26H27ClN2O4/c1-16-13-19(27)9-12-23(16)33-15-24(31)28-20-10-11-21(22(30)14-20)29-25(32)17-5-7-18(8-6-17)26(2,3)4/h5-14,30H,15H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | BMUWZDPZRFEIPK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|