C27H44N2O2 — CID 93232963
(1R,2S,10S,13S,14R,17S,18R)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-5-oxido-6-oxa-7-aza-5-azoniapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7-diene (PubChem CID 93232963) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is (1R,2S,10S,13S,14R,17S,18R)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-5-oxido-6-oxa-7-aza-5-azoniapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7-diene.
| Compound Name | (1R,2S,10S,13S,14R,17S,18R)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-5-oxido-6-oxa-7-aza-5-azoniapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7-diene |
|---|---|
| PubChem CID | 93232963 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | (1R,2S,10S,13S,14R,17S,18R)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-5-oxido-6-oxa-7-aza-5-azoniapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7-diene |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3CC[C@H]4Cc5no[n+]([O-])c5C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H44N2O2/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24-25(29(30)31-28-24)16-27(19,5)23(20)13-14-26(21,22)4/h17-23H,6-16H2,1-5H3/t18-,19+,20-,21+,22-,23-,26-,27+/m1/s1 |
| InChIKey | WOECLDQDCSEWTG-WRUPXOJVSA-N |
| XLogP | 6.34 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|