C24H32N4O3+2 — CID 9325338
(5R)-5-ethyl-3-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 9325338) has the molecular formula C24H32N4O3+2 and a molecular weight of 424.55 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9325338 |
| Molecular Formula | C24H32N4O3+2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (5R)-5-ethyl-3-[[4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(C[NH+]2CC[NH+](Cc3ccc(OC)cc3)CC2)C1=O |
| InChI | InChI=1S/C24H30N4O3/c1-3-24(20-7-5-4-6-8-20)22(29)28(23(30)25-24)18-27-15-13-26(14-16-27)17-19-9-11-21(31-2)12-10-19/h4-12H,3,13-18H2,1-2H3,(H,25,30)/p+2/t24-/m1/s1 |
| InChIKey | QISRWQXNCINZAR-XMMPIXPASA-P |
| XLogP | -0.21 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|