C8H15N3 — CID 93255324
(1R)-1-(4-ethyl-5-methyl-1H-imidazol-2-yl)ethanamine (PubChem CID 93255324) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (1R)-1-(4-ethyl-5-methyl-1H-imidazol-2-yl)ethanamine.
| Compound Name | (1R)-1-(4-ethyl-5-methyl-1H-imidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 93255324 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1R)-1-(4-ethyl-5-methyl-1H-imidazol-2-yl)ethanamine |
| SMILES | CCc1nc([C@@H](C)N)[nH]c1C |
| InChI | InChI=1S/C8H15N3/c1-4-7-6(3)10-8(11-7)5(2)9/h5H,4,9H2,1-3H3,(H,10,11)/t5-/m1/s1 |
| InChIKey | VPRXKLVURYTXMR-RXMQYKEDSA-N |
| XLogP | 1.30 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |