C6H12N4 — CID 176888618
(1S)-1-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 176888618) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is (1S)-1-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (1S)-1-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 176888618 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (1S)-1-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CCc1n[nH]c([C@H](C)N)n1 |
| InChI | InChI=1S/C6H12N4/c1-3-5-8-6(4(2)7)10-9-5/h4H,3,7H2,1-2H3,(H,8,9,10)/t4-/m0/s1 |
| InChIKey | JYXQLWGUUVLZPQ-BYPYZUCNSA-N |
| XLogP | 0.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |