C22H19N3O3 — CID 9327531
4-[2-(2-phenoxyanilino)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 9327531) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[2-(2-phenoxyanilino)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(2-phenoxyanilino)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 9327531 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 4-[2-(2-phenoxyanilino)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)CNc2ccccc2Oc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C22H19N3O3/c26-21-15-25(19-12-6-4-10-17(19)24-21)22(27)14-23-18-11-5-7-13-20(18)28-16-8-2-1-3-9-16/h1-13,23H,14-15H2,(H,24,26) |
| InChIKey | WPLZBXLKMCIZHC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |